C23H34O5S — CID 67855538
methyl (8S,9R,10R,13S,14S)-11-hydroxy-10,13-dimethyl-17-(methylsulfanylmethoxy)-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 67855538) has the molecular formula C23H34O5S and a molecular weight of 422.59 g/mol. Its IUPAC name is methyl (8S,9R,10R,13S,14S)-11-hydroxy-10,13-dimethyl-17-(methylsulfanylmethoxy)-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (8S,9R,10R,13S,14S)-11-hydroxy-10,13-dimethyl-17-(methylsulfanylmethoxy)-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 67855538 |
| Molecular Formula | C23H34O5S |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | methyl (8S,9R,10R,13S,14S)-11-hydroxy-10,13-dimethyl-17-(methylsulfanylmethoxy)-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)C1(OCSC)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C23H34O5S/c1-21-9-7-15(24)11-14(21)5-6-16-17-8-10-23(20(26)27-3,28-13-29-4)22(17,2)12-18(25)19(16)21/h11,16-19,25H,5-10,12-13H2,1-4H3/t16-,17-,18?,19-,21-,22-,23?/m0/s1 |
| InChIKey | DIWSGQQNTZKYFW-MAGXELRGSA-N |
| XLogP | 3.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|