C25H32ClF3O6S — CID 67855510
chloromethyl (8S,9R,10R,13S,14S)-10,13-dimethyl-17-(methylsulfanylmethoxy)-3-oxo-11-(2,2,2-trifluoroacetyl)oxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 67855510) has the molecular formula C25H32ClF3O6S and a molecular weight of 553.04 g/mol. Its IUPAC name is chloromethyl (8S,9R,10R,13S,14S)-10,13-dimethyl-17-(methylsulfanylmethoxy)-3-oxo-11-(2,2,2-trifluoroacetyl)oxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | chloromethyl (8S,9R,10R,13S,14S)-10,13-dimethyl-17-(methylsulfanylmethoxy)-3-oxo-11-(2,2,2-trifluoroacetyl)oxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 67855510 |
| Molecular Formula | C25H32ClF3O6S |
| Molecular Weight | 553.04 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | chloromethyl (8S,9R,10R,13S,14S)-10,13-dimethyl-17-(methylsulfanylmethoxy)-3-oxo-11-(2,2,2-trifluoroacetyl)oxy-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CSCOC1(C(=O)OCCl)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3C(OC(=O)C(F)(F)F)C[C@@]21C |
| InChI | InChI=1S/C25H32ClF3O6S/c1-22-8-6-15(30)10-14(22)4-5-16-17-7-9-24(34-13-36-3,20(31)33-12-26)23(17,2)11-18(19(16)22)35-21(32)25(27,28)29/h10,16-19H,4-9,11-13H2,1-3H3/t16-,17-,18?,19-,22-,23-,24?/m0/s1 |
| InChIKey | CBOAYNQKKDHHLB-PMQNDDHDSA-N |
| XLogP | 5.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.04 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|