C28H27F9O8 — CID 629620
[2-[10,13-dimethyl-16-methylidene-3-oxo-11,17-bis[(2,2,2-trifluoroacetyl)oxy]-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2,2-trifluoroacetate (PubChem CID 629620) has the molecular formula C28H27F9O8 and a molecular weight of 662.50 g/mol. Its IUPAC name is [2-[10,13-dimethyl-16-methylidene-3-oxo-11,17-bis[(2,2,2-trifluoroacetyl)oxy]-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[10,13-dimethyl-16-methylidene-3-oxo-11,17-bis[(2,2,2-trifluoroacetyl)oxy]-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 629620 |
| Molecular Formula | C28H27F9O8 |
| Molecular Weight | 662.50 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | [2-[10,13-dimethyl-16-methylidene-3-oxo-11,17-bis[(2,2,2-trifluoroacetyl)oxy]-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,2,2-trifluoroacetate |
| SMILES | C=C1CC2C3CCC4=CC(=O)CCC4(C)C3C(OC(=O)C(F)(F)F)CC2(C)C1(OC(=O)C(F)(F)F)C(=O)COC(=O)C(F)(F)F |
| InChI | InChI=1S/C28H27F9O8/c1-12-8-16-15-5-4-13-9-14(38)6-7-23(13,2)19(15)17(44-21(41)27(32,33)34)10-24(16,3)25(12,45-22(42)28(35,36)37)18(39)11-43-20(40)26(29,30)31/h9,15-17,19H,1,4-8,10-11H2,2-3H3 |
| InChIKey | DGOKYLOXWDTFPN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|