C13H19N3O — CID 18644147
(1R,2R,4S)-4-amino-2-methyl-N-pyridin-4-ylcyclohexane-1-carboxamide (PubChem CID 18644147) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (1R,2R,4S)-4-amino-2-methyl-N-pyridin-4-ylcyclohexane-1-carboxamide.
| Compound Name | (1R,2R,4S)-4-amino-2-methyl-N-pyridin-4-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18644147 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (1R,2R,4S)-4-amino-2-methyl-N-pyridin-4-ylcyclohexane-1-carboxamide |
| SMILES | C[C@@H]1C[C@@H](N)CC[C@H]1C(=O)Nc1ccncc1 |
| InChI | InChI=1S/C13H19N3O/c1-9-8-10(14)2-3-12(9)13(17)16-11-4-6-15-7-5-11/h4-7,9-10,12H,2-3,8,14H2,1H3,(H,15,16,17)/t9-,10+,12-/m1/s1 |
| InChIKey | LRDGQQNCFDDJRY-JFGNBEQYSA-N |
| XLogP | 1.78 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |