C24H26N2O5 — CID 18644347
tert-butyl N-[(2S)-1-(7-amino-4-methyl-2-oxochromen-3-yl)-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 18644347) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(7-amino-4-methyl-2-oxochromen-3-yl)-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(7-amino-4-methyl-2-oxochromen-3-yl)-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18644347 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | tert-butyl N-[(2S)-1-(7-amino-4-methyl-2-oxochromen-3-yl)-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | Cc1c(C(=O)[C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)c(=O)oc2cc(N)ccc12 |
| InChI | InChI=1S/C24H26N2O5/c1-14-17-11-10-16(25)13-19(17)30-22(28)20(14)21(27)18(12-15-8-6-5-7-9-15)26-23(29)31-24(2,3)4/h5-11,13,18H,12,25H2,1-4H3,(H,26,29)/t18-/m0/s1 |
| InChIKey | FEXDORKBYHNWTD-SFHVURJKSA-N |
| XLogP | 4.00 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|