C30H39N9O6 — CID 137321436
benzyl N-[(2S)-1-[[(2S)-1-(7-amino-4-methyl-2-oxochromen-3-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate (PubChem CID 137321436) has the molecular formula C30H39N9O6 and a molecular weight of 621.70 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1-(7-amino-4-methyl-2-oxochromen-3-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1-(7-amino-4-methyl-2-oxochromen-3-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 137321436 |
| Molecular Formula | C30H39N9O6 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1-(7-amino-4-methyl-2-oxochromen-3-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamate |
| SMILES | Cc1c(C(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCN=C(N)N)NC(=O)OCc2ccccc2)c(=O)oc2cc(N)ccc12 |
| InChI | InChI=1S/C30H39N9O6/c1-17-20-12-11-19(31)15-23(20)45-27(42)24(17)25(40)21(9-5-13-36-28(32)33)38-26(41)22(10-6-14-37-29(34)35)39-30(43)44-16-18-7-3-2-4-8-18/h2-4,7-8,11-12,15,21-22H,5-6,9-10,13-14,16,31H2,1H3,(H,38,41)(H,39,43)(H4,32,33,36)(H4,34,35,37)/t21-,22-/m0/s1 |
| InChIKey | GYWGTZATNXDQNJ-VXKWHMMOSA-N |
| XLogP | 0.75 |
| TPSA | 269.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|