About [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate
[4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate (PubChem CID 18647444) has the molecular formula C31H39FN2O4
and a molecular weight of 522.66 g/mol. Its IUPAC name is [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate.
Molecular Properties
| Compound Name | [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate |
| PubChem CID | 18647444 |
| Molecular Formula | C31H39FN2O4 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate |
| SMILES | CCCCCCCCCCOc1cnc(-c2ccc(-c3ccc(OC(=O)O[C@@H](F)CCC)cc3)cc2)nc1 |
| InChI | InChI=1S/C31H39FN2O4/c1-3-5-6-7-8-9-10-11-21-36-28-22-33-30(34-23-28)26-15-13-24(14-16-26)25-17-19-27(20-18-25)37-31(35)38-29(32)12-4-2/h13-20,22-23,29H,3-12,21H2,1-2H3/t29-/m1/s1 |
| InChIKey | ZHSORXRBTJILLX-GDLZYMKVSA-N |
| XLogP | 8.94 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate?
The IUPAC name of [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate (CID 18647444) is [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate.
What is the SMILES notation for [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate?
The canonical SMILES for [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate is CCCCCCCCCCOc1cnc(-c2ccc(-c3ccc(OC(=O)O[C@@H](F)CCC)cc3)cc2)nc1.
What is the InChIKey of [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate?
The InChIKey is ZHSORXRBTJILLX-GDLZYMKVSA-N. The full InChI is InChI=1S/C31H39FN2O4/c1-3-5-6-7-8-9-10-11-21-36-28-22-33-30(34-23-28)26-15-13-24(14-16-26)25-17-19-27(20-18-25)37-31(35)38-29(32)12-4-2/h13-20,22-23,29H,3-12,21H2,1-2H3/t29-/m1/s1.
What are the key properties of [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate?
[4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate has a molecular weight of 522.66 g/mol, XLogP of 8.94, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(5-decoxypyrimidin-2-yl)phenyl]phenyl] [(1S)-1-fluorobutyl] carbonate is sourced from PubChem (CID 18647444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).