C13H23NO4 — CID 18648443
2-O'-tert-butyl 2-O-methyl (2R)-4-methylpiperidine-2,2-dicarboxylate (PubChem CID 18648443) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-O'-tert-butyl 2-O-methyl (2R)-4-methylpiperidine-2,2-dicarboxylate.
| Compound Name | 2-O'-tert-butyl 2-O-methyl (2R)-4-methylpiperidine-2,2-dicarboxylate |
|---|---|
| PubChem CID | 18648443 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-O'-tert-butyl 2-O-methyl (2R)-4-methylpiperidine-2,2-dicarboxylate |
| SMILES | COC(=O)[C@@]1(C(=O)OC(C)(C)C)CC(C)CCN1 |
| InChI | InChI=1S/C13H23NO4/c1-9-6-7-14-13(8-9,10(15)17-5)11(16)18-12(2,3)4/h9,14H,6-8H2,1-5H3/t9?,13-/m1/s1 |
| InChIKey | XZTWZDBCZAXTHV-WCRCJTMVSA-N |
| XLogP | 1.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|