About 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine
5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine (PubChem CID 18648621) has the molecular formula C19H21F2NO2
and a molecular weight of 333.38 g/mol. Its IUPAC name is 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine.
Molecular Properties
| Compound Name | 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine |
| PubChem CID | 18648621 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine |
| SMILES | CCCCC1COC(c2ccc(-c3ccc(F)c(F)c3)nc2)OC1 |
| InChI | InChI=1S/C19H21F2NO2/c1-2-3-4-13-11-23-19(24-12-13)15-6-8-18(22-10-15)14-5-7-16(20)17(21)9-14/h5-10,13,19H,2-4,11-12H2,1H3 |
| InChIKey | SHPQIMAXNWDJDQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine?
The IUPAC name of 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine (CID 18648621) is 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine.
What is the SMILES notation for 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine?
The canonical SMILES for 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine is CCCCC1COC(c2ccc(-c3ccc(F)c(F)c3)nc2)OC1.
What is the InChIKey of 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine?
The InChIKey is SHPQIMAXNWDJDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F2NO2/c1-2-3-4-13-11-23-19(24-12-13)15-6-8-18(22-10-15)14-5-7-16(20)17(21)9-14/h5-10,13,19H,2-4,11-12H2,1H3.
What are the key properties of 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine?
5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine has a molecular weight of 333.38 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-butyl-1,3-dioxan-2-yl)-2-(3,4-difluorophenyl)pyridine is sourced from PubChem (CID 18648621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).