C33H47FO3 — CID 18649618
trans-(1R,4R)-3-fluoro-4-(4-heptoxyheptyl)-1-(4-phenylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 18649618) has the molecular formula C33H47FO3 and a molecular weight of 510.73 g/mol. Its IUPAC name is trans-(1R,4R)-3-fluoro-4-(4-heptoxyheptyl)-1-(4-phenylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1R,4R)-3-fluoro-4-(4-heptoxyheptyl)-1-(4-phenylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 18649618 |
| Molecular Formula | C33H47FO3 |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | trans-(1R,4R)-3-fluoro-4-(4-heptoxyheptyl)-1-(4-phenylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCOC(CCC)CCC[C@@H]1CC[C@](C(=O)O)(c2ccc(-c3ccccc3)cc2)CC1F |
| InChI | InChI=1S/C33H47FO3/c1-3-5-6-7-11-24-37-30(13-4-2)17-12-16-28-22-23-33(32(35)36,25-31(28)34)29-20-18-27(19-21-29)26-14-9-8-10-15-26/h8-10,14-15,18-21,28,30-31H,3-7,11-13,16-17,22-25H2,1-2H3,(H,35,36)/t28-,30?,31?,33-/m1/s1 |
| InChIKey | YKXQGNMGFPXCQJ-KEWVWNMTSA-N |
| XLogP | 9.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|