C24H32N4O5S — CID 18650986
2-ethoxyethyl (2S)-4-methyl-2-[[4-[(2-methyl-1H-imidazo[4,5-c]pyridin-4-yl)methyl]phenyl]sulfonylamino]pentanoate (PubChem CID 18650986) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 2-ethoxyethyl (2S)-4-methyl-2-[[4-[(2-methyl-1H-imidazo[4,5-c]pyridin-4-yl)methyl]phenyl]sulfonylamino]pentanoate.
| Compound Name | 2-ethoxyethyl (2S)-4-methyl-2-[[4-[(2-methyl-1H-imidazo[4,5-c]pyridin-4-yl)methyl]phenyl]sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 18650986 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 2-ethoxyethyl (2S)-4-methyl-2-[[4-[(2-methyl-1H-imidazo[4,5-c]pyridin-4-yl)methyl]phenyl]sulfonylamino]pentanoate |
| SMILES | CCOCCOC(=O)[C@H](CC(C)C)NS(=O)(=O)c1ccc(Cc2nccc3[nH]c(C)nc23)cc1 |
| InChI | InChI=1S/C24H32N4O5S/c1-5-32-12-13-33-24(29)22(14-16(2)3)28-34(30,31)19-8-6-18(7-9-19)15-21-23-20(10-11-25-21)26-17(4)27-23/h6-11,16,22,28H,5,12-15H2,1-4H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | TVDYYAZTXIJOIH-QFIPXVFZSA-N |
| XLogP | 3.13 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|