C27H28FNO4S — CID 18654036
(NE)-N-[1-[4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanyl-2-phenylmethoxyphenyl]ethylidene]hydroxylamine (PubChem CID 18654036) has the molecular formula C27H28FNO4S and a molecular weight of 481.59 g/mol. Its IUPAC name is (NE)-N-[1-[4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanyl-2-phenylmethoxyphenyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanyl-2-phenylmethoxyphenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 18654036 |
| Molecular Formula | C27H28FNO4S |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | (NE)-N-[1-[4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanyl-2-phenylmethoxyphenyl]ethylidene]hydroxylamine |
| SMILES | COC1(c2cc(F)cc(Sc3ccc(/C(C)=N/O)c(OCc4ccccc4)c3)c2)CCOCC1 |
| InChI | InChI=1S/C27H28FNO4S/c1-19(29-30)25-9-8-23(17-26(25)33-18-20-6-4-3-5-7-20)34-24-15-21(14-22(28)16-24)27(31-2)10-12-32-13-11-27/h3-9,14-17,30H,10-13,18H2,1-2H3/b29-19+ |
| InChIKey | NOOVSQAAGFGTBX-VUTHCHCSSA-N |
| XLogP | 6.41 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|