C19H21ClFNO4S2 — CID 19785614
N-[2-chloro-4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]methanesulfonamide (PubChem CID 19785614) has the molecular formula C19H21ClFNO4S2 and a molecular weight of 445.97 g/mol. Its IUPAC name is N-[2-chloro-4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 19785614 |
| Molecular Formula | C19H21ClFNO4S2 |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N-[2-chloro-4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]methanesulfonamide |
| SMILES | COC1(c2cc(F)cc(Sc3ccc(NS(C)(=O)=O)c(Cl)c3)c2)CCOCC1 |
| InChI | InChI=1S/C19H21ClFNO4S2/c1-25-19(5-7-26-8-6-19)13-9-14(21)11-16(10-13)27-15-3-4-18(17(20)12-15)22-28(2,23)24/h3-4,9-12,22H,5-8H2,1-2H3 |
| InChIKey | UDZBJKKWHBHNNJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |