C22H28O3S — CID 19764814
4-methoxy-4-[3-[4-(2-methoxypropan-2-yl)phenyl]sulfanylphenyl]oxane (PubChem CID 19764814) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is 4-methoxy-4-[3-[4-(2-methoxypropan-2-yl)phenyl]sulfanylphenyl]oxane.
| Compound Name | 4-methoxy-4-[3-[4-(2-methoxypropan-2-yl)phenyl]sulfanylphenyl]oxane |
|---|---|
| PubChem CID | 19764814 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-methoxy-4-[3-[4-(2-methoxypropan-2-yl)phenyl]sulfanylphenyl]oxane |
| SMILES | COC(C)(C)c1ccc(Sc2cccc(C3(OC)CCOCC3)c2)cc1 |
| InChI | InChI=1S/C22H28O3S/c1-21(2,23-3)17-8-10-19(11-9-17)26-20-7-5-6-18(16-20)22(24-4)12-14-25-15-13-22/h5-11,16H,12-15H2,1-4H3 |
| InChIKey | JLTFZAKPCOMRJH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |