C22H28N2O3S — CID 15288267
1-[4-[3-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]-1,3,3-trimethylurea (PubChem CID 15288267) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 1-[4-[3-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]-1,3,3-trimethylurea.
| Compound Name | 1-[4-[3-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 15288267 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-[4-[3-(4-methoxyoxan-4-yl)phenyl]sulfanylphenyl]-1,3,3-trimethylurea |
| SMILES | COC1(c2cccc(Sc3ccc(N(C)C(=O)N(C)C)cc3)c2)CCOCC1 |
| InChI | InChI=1S/C22H28N2O3S/c1-23(2)21(25)24(3)18-8-10-19(11-9-18)28-20-7-5-6-17(16-20)22(26-4)12-14-27-15-13-22/h5-11,16H,12-15H2,1-4H3 |
| InChIKey | QQDUKMWRLUCNFK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |