C23H31N3O3 — CID 19925619
3-[2-[3-(4-methoxyoxan-4-yl)anilino]-2-phenylethyl]-1,1-dimethylurea (PubChem CID 19925619) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-[2-[3-(4-methoxyoxan-4-yl)anilino]-2-phenylethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[3-(4-methoxyoxan-4-yl)anilino]-2-phenylethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 19925619 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 3-[2-[3-(4-methoxyoxan-4-yl)anilino]-2-phenylethyl]-1,1-dimethylurea |
| SMILES | COC1(c2cccc(NC(CNC(=O)N(C)C)c3ccccc3)c2)CCOCC1 |
| InChI | InChI=1S/C23H31N3O3/c1-26(2)22(27)24-17-21(18-8-5-4-6-9-18)25-20-11-7-10-19(16-20)23(28-3)12-14-29-15-13-23/h4-11,16,21,25H,12-15,17H2,1-3H3,(H,24,27) |
| InChIKey | CXFBMXLPRVPNHM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |