C27H31NO5S — CID 53324810
N-[[3-(4-methoxyoxan-4-yl)phenyl]methyl]-N-(2-phenylmethoxyphenyl)methanesulfonamide (PubChem CID 53324810) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is N-[[3-(4-methoxyoxan-4-yl)phenyl]methyl]-N-(2-phenylmethoxyphenyl)methanesulfonamide.
| Compound Name | N-[[3-(4-methoxyoxan-4-yl)phenyl]methyl]-N-(2-phenylmethoxyphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 53324810 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | N-[[3-(4-methoxyoxan-4-yl)phenyl]methyl]-N-(2-phenylmethoxyphenyl)methanesulfonamide |
| SMILES | COC1(c2cccc(CN(c3ccccc3OCc3ccccc3)S(C)(=O)=O)c2)CCOCC1 |
| InChI | InChI=1S/C27H31NO5S/c1-31-27(15-17-32-18-16-27)24-12-8-11-23(19-24)20-28(34(2,29)30)25-13-6-7-14-26(25)33-21-22-9-4-3-5-10-22/h3-14,19H,15-18,20-21H2,1-2H3 |
| InChIKey | QQVPHDTXMGWCCI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |