C21H28N2O6 — CID 18654851
(2S)-1-[2-[[(1S)-1-carboxy-2-phenoxyethyl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 18654851) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is (2S)-1-[2-[[(1S)-1-carboxy-2-phenoxyethyl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[[(1S)-1-carboxy-2-phenoxyethyl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 18654851 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (2S)-1-[2-[[(1S)-1-carboxy-2-phenoxyethyl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | CC(N[C@@H](COc1ccccc1)C(=O)O)C(=O)N1C2CCCCC2C[C@H]1C(=O)O |
| InChI | InChI=1S/C21H28N2O6/c1-13(22-16(20(25)26)12-29-15-8-3-2-4-9-15)19(24)23-17-10-6-5-7-14(17)11-18(23)21(27)28/h2-4,8-9,13-14,16-18,22H,5-7,10-12H2,1H3,(H,25,26)(H,27,28)/t13?,14?,16-,17?,18-/m0/s1 |
| InChIKey | LRWDZYDFIUYNRG-QCHHRXENSA-N |
| XLogP | 1.74 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |