C22H30N2O5S — CID 67852331
(2S)-1-[(2S)-2-[(2-benzylsulfanyl-1-carboxyethyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid (PubChem CID 67852331) has the molecular formula C22H30N2O5S and a molecular weight of 434.56 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(2-benzylsulfanyl-1-carboxyethyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[(2-benzylsulfanyl-1-carboxyethyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 67852331 |
| Molecular Formula | C22H30N2O5S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (2S)-1-[(2S)-2-[(2-benzylsulfanyl-1-carboxyethyl)amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid |
| SMILES | C[C@H](NC(CSCc1ccccc1)C(=O)O)C(=O)N1C2CCCCC2C[C@H]1C(=O)O |
| InChI | InChI=1S/C22H30N2O5S/c1-14(23-17(21(26)27)13-30-12-15-7-3-2-4-8-15)20(25)24-18-10-6-5-9-16(18)11-19(24)22(28)29/h2-4,7-8,14,16-19,23H,5-6,9-13H2,1H3,(H,26,27)(H,28,29)/t14-,16?,17?,18?,19-/m0/s1 |
| InChIKey | GJZBRLCAJBSPCF-ZKNZNYJQSA-N |
| XLogP | 2.60 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |