C20H31NO2 — CID 18655915
(3aS,3bR,5aR,9aR,9bS,11aS)-8-ethyl-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinoline-1,7-dione (PubChem CID 18655915) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (3aS,3bR,5aR,9aR,9bS,11aS)-8-ethyl-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinoline-1,7-dione.
| Compound Name | (3aS,3bR,5aR,9aR,9bS,11aS)-8-ethyl-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinoline-1,7-dione |
|---|---|
| PubChem CID | 18655915 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (3aS,3bR,5aR,9aR,9bS,11aS)-8-ethyl-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinoline-1,7-dione |
| SMILES | CCC1C[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)NC1=O |
| InChI | InChI=1S/C20H31NO2/c1-4-12-11-20(3)15-9-10-19(2)14(6-8-17(19)22)13(15)5-7-16(20)21-18(12)23/h12-16H,4-11H2,1-3H3,(H,21,23)/t12?,13-,14-,15-,16+,19-,20+/m0/s1 |
| InChIKey | HOQDIGUIFBXZFQ-ADBGUEMRSA-N |
| XLogP | 3.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |