C10H10BrClN2O3 — CID 18656062
(2S)-2-amino-4-(2-amino-6-bromo-4-chlorophenyl)-4-oxobutanoic acid (PubChem CID 18656062) has the molecular formula C10H10BrClN2O3 and a molecular weight of 321.56 g/mol. Its IUPAC name is (2S)-2-amino-4-(2-amino-6-bromo-4-chlorophenyl)-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-(2-amino-6-bromo-4-chlorophenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18656062 |
| Molecular Formula | C10H10BrClN2O3 |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | (2S)-2-amino-4-(2-amino-6-bromo-4-chlorophenyl)-4-oxobutanoic acid |
| SMILES | Nc1cc(Cl)cc(Br)c1C(=O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H10BrClN2O3/c11-5-1-4(12)2-6(13)9(5)8(15)3-7(14)10(16)17/h1-2,7H,3,13-14H2,(H,16,17)/t7-/m0/s1 |
| InChIKey | OAFMTNZHJYCPNZ-ZETCQYMHSA-N |
| XLogP | 1.67 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|