C14H17FINO — CID 18659987
N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide (PubChem CID 18659987) has the molecular formula C14H17FINO and a molecular weight of 361.20 g/mol. Its IUPAC name is N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide.
| Compound Name | N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide |
|---|---|
| PubChem CID | 18659987 |
| Molecular Formula | C14H17FINO |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide |
| SMILES | CCCC(=O)NC[C@@H]1C[C@H]1c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C14H17FINO/c1-2-3-14(18)17-8-10-6-11(10)9-4-5-13(16)12(15)7-9/h4-5,7,10-11H,2-3,6,8H2,1H3,(H,17,18)/t10-,11-/m0/s1 |
| InChIKey | KSMUJEYCUSZZRD-QWRGUYRKSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|