About N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide
N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide (PubChem CID 18659987) has the molecular formula C14H17FINO
and a molecular weight of 361.20 g/mol. Its IUPAC name is N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide.
Molecular Properties
| Compound Name | N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide |
| PubChem CID | 18659987 |
| Molecular Formula | C14H17FINO |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide |
| SMILES | CCCC(=O)NC[C@@H]1C[C@H]1c1ccc(I)c(F)c1 |
| InChI | InChI=1S/C14H17FINO/c1-2-3-14(18)17-8-10-6-11(10)9-4-5-13(16)12(15)7-9/h4-5,7,10-11H,2-3,6,8H2,1H3,(H,17,18)/t10-,11-/m0/s1 |
| InChIKey | KSMUJEYCUSZZRD-QWRGUYRKSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide?
The IUPAC name of N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide (CID 18659987) is N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide.
What is the SMILES notation for N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide?
The canonical SMILES for N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide is CCCC(=O)NC[C@@H]1C[C@H]1c1ccc(I)c(F)c1.
What is the InChIKey of N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide?
The InChIKey is KSMUJEYCUSZZRD-QWRGUYRKSA-N. The full InChI is InChI=1S/C14H17FINO/c1-2-3-14(18)17-8-10-6-11(10)9-4-5-13(16)12(15)7-9/h4-5,7,10-11H,2-3,6,8H2,1H3,(H,17,18)/t10-,11-/m0/s1.
What are the key properties of N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide?
N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide has a molecular weight of 361.20 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,2R)-2-(3-fluoro-4-iodophenyl)cyclopropyl]methyl]butanamide is sourced from PubChem (CID 18659987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).