C26H43NO2 — CID 70274375
N-[[(1R,2R)-2-(2-dodecan-3-yloxyphenyl)cyclopropyl]methyl]butanamide (PubChem CID 70274375) has the molecular formula C26H43NO2 and a molecular weight of 401.64 g/mol. Its IUPAC name is N-[[(1R,2R)-2-(2-dodecan-3-yloxyphenyl)cyclopropyl]methyl]butanamide.
| Compound Name | N-[[(1R,2R)-2-(2-dodecan-3-yloxyphenyl)cyclopropyl]methyl]butanamide |
|---|---|
| PubChem CID | 70274375 |
| Molecular Formula | C26H43NO2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.33 |
| IUPAC Name | N-[[(1R,2R)-2-(2-dodecan-3-yloxyphenyl)cyclopropyl]methyl]butanamide |
| SMILES | CCCCCCCCCC(CC)Oc1ccccc1[C@@H]1C[C@H]1CNC(=O)CCC |
| InChI | InChI=1S/C26H43NO2/c1-4-7-8-9-10-11-12-16-22(6-3)29-25-18-14-13-17-23(25)24-19-21(24)20-27-26(28)15-5-2/h13-14,17-18,21-22,24H,4-12,15-16,19-20H2,1-3H3,(H,27,28)/t21-,22?,24+/m0/s1 |
| InChIKey | OYYKQTCTZHWFFP-RRUPDEEPSA-N |
| XLogP | 7.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|