C32H42N4O7S — CID 18662668
N-[(2R,3S)-2-hydroxy-3-[pent-4-ynoyl-(pyrrolidine-2-carbonylamino)amino]-4-phenylbutyl]-N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide (PubChem CID 18662668) has the molecular formula C32H42N4O7S and a molecular weight of 626.78 g/mol. Its IUPAC name is N-[(2R,3S)-2-hydroxy-3-[pent-4-ynoyl-(pyrrolidine-2-carbonylamino)amino]-4-phenylbutyl]-N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide.
| Compound Name | N-[(2R,3S)-2-hydroxy-3-[pent-4-ynoyl-(pyrrolidine-2-carbonylamino)amino]-4-phenylbutyl]-N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
|---|---|
| PubChem CID | 18662668 |
| Molecular Formula | C32H42N4O7S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | N-[(2R,3S)-2-hydroxy-3-[pent-4-ynoyl-(pyrrolidine-2-carbonylamino)amino]-4-phenylbutyl]-N-(2-methylpropyl)-2,3-dihydro-1,4-benzodioxine-6-sulfonamide |
| SMILES | C#CCCC(=O)N(NC(=O)C1CCCN1)[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C32H42N4O7S/c1-4-5-13-31(38)36(34-32(39)26-12-9-16-33-26)27(19-24-10-7-6-8-11-24)28(37)22-35(21-23(2)3)44(40,41)25-14-15-29-30(20-25)43-18-17-42-29/h1,6-8,10-11,14-15,20,23,26-28,33,37H,5,9,12-13,16-19,21-22H2,2-3H3,(H,34,39)/t26?,27-,28+/m0/s1 |
| InChIKey | AZEAQYCISJPZJH-GUQXXGRISA-N |
| XLogP | 2.10 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|