C28H34ClN3O7S — CID 57214798
N-[(2R,3S)-3-[[(2-chloroacetyl)amino]-pent-4-ynoylamino]-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-1,3-benzodioxole-5-sulfonamide (PubChem CID 57214798) has the molecular formula C28H34ClN3O7S and a molecular weight of 592.11 g/mol. Its IUPAC name is N-[(2R,3S)-3-[[(2-chloroacetyl)amino]-pent-4-ynoylamino]-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-1,3-benzodioxole-5-sulfonamide.
| Compound Name | N-[(2R,3S)-3-[[(2-chloroacetyl)amino]-pent-4-ynoylamino]-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-1,3-benzodioxole-5-sulfonamide |
|---|---|
| PubChem CID | 57214798 |
| Molecular Formula | C28H34ClN3O7S |
| Molecular Weight | 592.11 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | N-[(2R,3S)-3-[[(2-chloroacetyl)amino]-pent-4-ynoylamino]-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)-1,3-benzodioxole-5-sulfonamide |
| SMILES | C#CCCC(=O)N(NC(=O)CCl)[C@@H](Cc1ccccc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H34ClN3O7S/c1-4-5-11-28(35)32(30-27(34)16-29)23(14-21-9-7-6-8-10-21)24(33)18-31(17-20(2)3)40(36,37)22-12-13-25-26(15-22)39-19-38-25/h1,6-10,12-13,15,20,23-24,33H,5,11,14,16-19H2,2-3H3,(H,30,34)/t23-,24+/m0/s1 |
| InChIKey | RDERQPQSCKMOGQ-BJKOFHAPSA-N |
| XLogP | 2.55 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.11 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|