About 3-chlorobutan-2-yl hydrogen carbonate
3-chlorobutan-2-yl hydrogen carbonate (PubChem CID 18667716) has the molecular formula C5H9ClO3
and a molecular weight of 152.58 g/mol. Its IUPAC name is 3-chlorobutan-2-yl hydrogen carbonate.
Molecular Properties
| Compound Name | 3-chlorobutan-2-yl hydrogen carbonate |
| PubChem CID | 18667716 |
| Molecular Formula | C5H9ClO3 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 3-chlorobutan-2-yl hydrogen carbonate |
| SMILES | CC(Cl)C(C)OC(=O)O |
| InChI | InChI=1S/C5H9ClO3/c1-3(6)4(2)9-5(7)8/h3-4H,1-2H3,(H,7,8) |
| InChIKey | DARWLDOSIAZDME-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobutan-2-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobutan-2-yl hydrogen carbonate?
The IUPAC name of 3-chlorobutan-2-yl hydrogen carbonate (CID 18667716) is 3-chlorobutan-2-yl hydrogen carbonate.
What is the SMILES notation for 3-chlorobutan-2-yl hydrogen carbonate?
The canonical SMILES for 3-chlorobutan-2-yl hydrogen carbonate is CC(Cl)C(C)OC(=O)O.
What is the InChIKey of 3-chlorobutan-2-yl hydrogen carbonate?
The InChIKey is DARWLDOSIAZDME-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO3/c1-3(6)4(2)9-5(7)8/h3-4H,1-2H3,(H,7,8).
What are the key properties of 3-chlorobutan-2-yl hydrogen carbonate?
3-chlorobutan-2-yl hydrogen carbonate has a molecular weight of 152.58 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobutan-2-yl hydrogen carbonate is sourced from PubChem (CID 18667716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).