C19H26N2O2 — CID 18670621
2-(3-benzyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-ylidene)butanoic acid (PubChem CID 18670621) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-(3-benzyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-ylidene)butanoic acid.
| Compound Name | 2-(3-benzyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-ylidene)butanoic acid |
|---|---|
| PubChem CID | 18670621 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-(3-benzyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-ylidene)butanoic acid |
| SMILES | CCC(C(=O)O)=C1C2CN(C)CC1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C19H26N2O2/c1-3-17(19(22)23)18-15-10-20(2)11-16(18)13-21(12-15)9-14-7-5-4-6-8-14/h4-8,15-16H,3,9-13H2,1-2H3,(H,22,23) |
| InChIKey | PHJDQGPVINPRPH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|