About 1-(ethylamino)pyrrole-2,5-dione
1-(ethylamino)pyrrole-2,5-dione (PubChem CID 18671275) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 1-(ethylamino)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(ethylamino)pyrrole-2,5-dione |
| PubChem CID | 18671275 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-(ethylamino)pyrrole-2,5-dione |
| SMILES | CCNN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H8N2O2/c1-2-7-8-5(9)3-4-6(8)10/h3-4,7H,2H2,1H3 |
| InChIKey | UVKFDCOOPNCVMD-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(ethylamino)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylamino)pyrrole-2,5-dione?
The IUPAC name of 1-(ethylamino)pyrrole-2,5-dione (CID 18671275) is 1-(ethylamino)pyrrole-2,5-dione.
What is the SMILES notation for 1-(ethylamino)pyrrole-2,5-dione?
The canonical SMILES for 1-(ethylamino)pyrrole-2,5-dione is CCNN1C(=O)C=CC1=O.
What is the InChIKey of 1-(ethylamino)pyrrole-2,5-dione?
The InChIKey is UVKFDCOOPNCVMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-2-7-8-5(9)3-4-6(8)10/h3-4,7H,2H2,1H3.
What are the key properties of 1-(ethylamino)pyrrole-2,5-dione?
1-(ethylamino)pyrrole-2,5-dione has a molecular weight of 140.14 g/mol, XLogP of -0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylamino)pyrrole-2,5-dione is sourced from PubChem (CID 18671275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).