About 7-chloro-3,4-dihydro-2H-isoquinolin-1-one
7-chloro-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 18672397) has the molecular formula C9H8ClNO
and a molecular weight of 181.62 g/mol. Its IUPAC name is 7-chloro-3,4-dihydro-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 7-chloro-3,4-dihydro-2H-isoquinolin-1-one |
| PubChem CID | 18672397 |
| Molecular Formula | C9H8ClNO |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 7-chloro-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C1NCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H8ClNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | NMZRTRAYSHQMPR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloro-3,4-dihydro-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3,4-dihydro-2H-isoquinolin-1-one?
The IUPAC name of 7-chloro-3,4-dihydro-2H-isoquinolin-1-one (CID 18672397) is 7-chloro-3,4-dihydro-2H-isoquinolin-1-one.
What is the SMILES notation for 7-chloro-3,4-dihydro-2H-isoquinolin-1-one?
The canonical SMILES for 7-chloro-3,4-dihydro-2H-isoquinolin-1-one is O=C1NCCc2ccc(Cl)cc21.
What is the InChIKey of 7-chloro-3,4-dihydro-2H-isoquinolin-1-one?
The InChIKey is NMZRTRAYSHQMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-2,5H,3-4H2,(H,11,12).
What are the key properties of 7-chloro-3,4-dihydro-2H-isoquinolin-1-one?
7-chloro-3,4-dihydro-2H-isoquinolin-1-one has a molecular weight of 181.62 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3,4-dihydro-2H-isoquinolin-1-one is sourced from PubChem (CID 18672397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).