C24H20ClFN4O — CID 18674041
2-chloro-N-[3-(4-fluorophenyl)-1-methyl-4-pyridin-4-ylpyrazol-5-yl]-2-(4-methylphenyl)acetamide (PubChem CID 18674041) has the molecular formula C24H20ClFN4O and a molecular weight of 434.90 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-fluorophenyl)-1-methyl-4-pyridin-4-ylpyrazol-5-yl]-2-(4-methylphenyl)acetamide.
| Compound Name | 2-chloro-N-[3-(4-fluorophenyl)-1-methyl-4-pyridin-4-ylpyrazol-5-yl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 18674041 |
| Molecular Formula | C24H20ClFN4O |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2-chloro-N-[3-(4-fluorophenyl)-1-methyl-4-pyridin-4-ylpyrazol-5-yl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(Cl)C(=O)Nc2c(-c3ccncc3)c(-c3ccc(F)cc3)nn2C)cc1 |
| InChI | InChI=1S/C24H20ClFN4O/c1-15-3-5-17(6-4-15)21(25)24(31)28-23-20(16-11-13-27-14-12-16)22(29-30(23)2)18-7-9-19(26)10-8-18/h3-14,21H,1-2H3,(H,28,31) |
| InChIKey | YTDQJXJFXOMDQB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|