C23H19ClFN5O — CID 18674096
2-(4-amino-2-chlorophenyl)-N-[3-(4-fluorophenyl)-1-methyl-4-pyridin-4-ylpyrazol-5-yl]acetamide (PubChem CID 18674096) has the molecular formula C23H19ClFN5O and a molecular weight of 435.89 g/mol. Its IUPAC name is 2-(4-amino-2-chlorophenyl)-N-[3-(4-fluorophenyl)-1-methyl-4-pyridin-4-ylpyrazol-5-yl]acetamide.
| Compound Name | 2-(4-amino-2-chlorophenyl)-N-[3-(4-fluorophenyl)-1-methyl-4-pyridin-4-ylpyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 18674096 |
| Molecular Formula | C23H19ClFN5O |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-(4-amino-2-chlorophenyl)-N-[3-(4-fluorophenyl)-1-methyl-4-pyridin-4-ylpyrazol-5-yl]acetamide |
| SMILES | Cn1nc(-c2ccc(F)cc2)c(-c2ccncc2)c1NC(=O)Cc1ccc(N)cc1Cl |
| InChI | InChI=1S/C23H19ClFN5O/c1-30-23(28-20(31)12-16-4-7-18(26)13-19(16)24)21(14-8-10-27-11-9-14)22(29-30)15-2-5-17(25)6-3-15/h2-11,13H,12,26H2,1H3,(H,28,31) |
| InChIKey | FLERWIAZEDWINV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|