C24H22FN5O — CID 18674159
2-[4-(dimethylamino)phenyl]-N-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]acetamide (PubChem CID 18674159) has the molecular formula C24H22FN5O and a molecular weight of 415.47 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-N-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]acetamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-N-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 18674159 |
| Molecular Formula | C24H22FN5O |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-N-[5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]acetamide |
| SMILES | CN(C)c1ccc(CC(=O)Nc2n[nH]c(-c3ccc(F)cc3)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C24H22FN5O/c1-30(2)20-9-3-16(4-10-20)15-21(31)27-24-22(17-11-13-26-14-12-17)23(28-29-24)18-5-7-19(25)8-6-18/h3-14H,15H2,1-2H3,(H2,27,28,29,31) |
| InChIKey | GDBJBOKOOYSPCQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|