About azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine
azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine (PubChem CID 174449300) has the molecular formula C21H28FN5
and a molecular weight of 369.49 g/mol. Its IUPAC name is azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine |
| PubChem CID | 174449300 |
| Molecular Formula | C21H28FN5 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine |
| SMILES | CCC(CC)(CC)Nc1n[nH]c(-c2ccc(F)cc2)c1-c1ccncc1.N |
| InChI | InChI=1S/C21H25FN4.H3N/c1-4-21(5-2,6-3)24-20-18(15-11-13-23-14-12-15)19(25-26-20)16-7-9-17(22)10-8-16;/h7-14H,4-6H2,1-3H3,(H2,24,25,26);1H3 |
| InChIKey | OWGSDZZLARMIOF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine?
The IUPAC name of azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine (CID 174449300) is azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine.
What is the SMILES notation for azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine?
The canonical SMILES for azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine is CCC(CC)(CC)Nc1n[nH]c(-c2ccc(F)cc2)c1-c1ccncc1.N.
What is the InChIKey of azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine?
The InChIKey is OWGSDZZLARMIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25FN4.H3N/c1-4-21(5-2,6-3)24-20-18(15-11-13-23-14-12-15)19(25-26-20)16-7-9-17(22)10-8-16;/h7-14H,4-6H2,1-3H3,(H2,24,25,26);1H3.
What are the key properties of azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine?
azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine has a molecular weight of 369.49 g/mol, XLogP of 5.82, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-(3-ethylpentan-3-yl)-5-(4-fluorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-amine is sourced from PubChem (CID 174449300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).