C27H51NO4Sn — CID 18674803
[3-[(E)-1-acetyloxy-5-tributylstannylpent-4-enyl]-1-methylpiperidin-4-yl] acetate (PubChem CID 18674803) has the molecular formula C27H51NO4Sn and a molecular weight of 572.42 g/mol. Its IUPAC name is [3-[(E)-1-acetyloxy-5-tributylstannylpent-4-enyl]-1-methylpiperidin-4-yl] acetate.
| Compound Name | [3-[(E)-1-acetyloxy-5-tributylstannylpent-4-enyl]-1-methylpiperidin-4-yl] acetate |
|---|---|
| PubChem CID | 18674803 |
| Molecular Formula | C27H51NO4Sn |
| Molecular Weight | 572.42 g/mol |
| Exact Mass | 573.28 |
| IUPAC Name | [3-[(E)-1-acetyloxy-5-tributylstannylpent-4-enyl]-1-methylpiperidin-4-yl] acetate |
| SMILES | CCCC[Sn](/C=C/CCC(OC(C)=O)C1CN(C)CCC1OC(C)=O)(CCCC)CCCC |
| InChI | InChI=1S/C15H24NO4.3C4H9.Sn/c1-5-6-7-14(19-11(2)17)13-10-16(4)9-8-15(13)20-12(3)18;3*1-3-4-2;/h1,5,13-15H,6-10H2,2-4H3;3*1,3-4H2,2H3; |
| InChIKey | JKFSGZGXCIBBAW-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.42 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |