C15H26INO4 — CID 10501544
[3-[(E)-5-(123I)iodo-1-(methoxymethoxy)pent-4-enyl]-1-methylpiperidin-4-yl] acetate (PubChem CID 10501544) has the molecular formula C15H26INO4 and a molecular weight of 407.28 g/mol. Its IUPAC name is [3-[(E)-5-(123I)iodo-1-(methoxymethoxy)pent-4-enyl]-1-methylpiperidin-4-yl] acetate.
| Compound Name | [3-[(E)-5-(123I)iodo-1-(methoxymethoxy)pent-4-enyl]-1-methylpiperidin-4-yl] acetate |
|---|---|
| PubChem CID | 10501544 |
| Molecular Formula | C15H26INO4 |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [3-[(E)-5-(123I)iodo-1-(methoxymethoxy)pent-4-enyl]-1-methylpiperidin-4-yl] acetate |
| SMILES | COCOC(CC/C=C/[123I])C1CN(C)CCC1OC(C)=O |
| InChI | InChI=1S/C15H26INO4/c1-12(18)21-15-7-9-17(2)10-13(15)14(20-11-19-3)6-4-5-8-16/h5,8,13-15H,4,6-7,9-11H2,1-3H3/b8-5+/i16-4 |
| InChIKey | CXXVGUHRYNABHE-XNVJMEAFSA-N |
| XLogP | 2.59 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|