C15H24INO4 — CID 59033115
[3-[(E)-1-acetyloxy-5-(123I)iodopent-4-enyl]-1-methylpiperidin-4-yl] acetate (PubChem CID 59033115) has the molecular formula C15H24INO4 and a molecular weight of 405.27 g/mol. Its IUPAC name is [3-[(E)-1-acetyloxy-5-(123I)iodopent-4-enyl]-1-methylpiperidin-4-yl] acetate.
| Compound Name | [3-[(E)-1-acetyloxy-5-(123I)iodopent-4-enyl]-1-methylpiperidin-4-yl] acetate |
|---|---|
| PubChem CID | 59033115 |
| Molecular Formula | C15H24INO4 |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [3-[(E)-1-acetyloxy-5-(123I)iodopent-4-enyl]-1-methylpiperidin-4-yl] acetate |
| SMILES | CC(=O)OC(CC/C=C/[123I])C1CN(C)CCC1OC(C)=O |
| InChI | InChI=1S/C15H24INO4/c1-11(18)20-14(6-4-5-8-16)13-10-17(3)9-7-15(13)21-12(2)19/h5,8,13-15H,4,6-7,9-10H2,1-3H3/b8-5+/i16-4 |
| InChIKey | ILFQLSLUQCDFHF-XNVJMEAFSA-N |
| XLogP | 2.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|