C15H23F3INO4 — CID 159985937
[3-[(E)-1-hydroxy-5-iodopent-4-enyl]-1-methylpiperidin-4-yl] acetate;2,2,2-trifluoroacetaldehyde (PubChem CID 159985937) has the molecular formula C15H23F3INO4 and a molecular weight of 465.25 g/mol. Its IUPAC name is [3-[(E)-1-hydroxy-5-iodopent-4-enyl]-1-methylpiperidin-4-yl] acetate;2,2,2-trifluoroacetaldehyde.
| Compound Name | [3-[(E)-1-hydroxy-5-iodopent-4-enyl]-1-methylpiperidin-4-yl] acetate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159985937 |
| Molecular Formula | C15H23F3INO4 |
| Molecular Weight | 465.25 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | [3-[(E)-1-hydroxy-5-iodopent-4-enyl]-1-methylpiperidin-4-yl] acetate;2,2,2-trifluoroacetaldehyde |
| SMILES | CC(=O)OC1CCN(C)CC1C(O)CC/C=C/I.O=CC(F)(F)F |
| InChI | InChI=1S/C13H22INO3.C2HF3O/c1-10(16)18-13-6-8-15(2)9-11(13)12(17)5-3-4-7-14;3-2(4,5)1-6/h4,7,11-13,17H,3,5-6,8-9H2,1-2H3;1H/b7-4+; |
| InChIKey | OGIJIVKIMWKEAW-KQGICBIGSA-N |
| XLogP | 2.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|