C13H22INO3 — CID 91275561
[3-(1-hydroxy-5-(123I)iodopent-4-enyl)-1-methylpiperidin-4-yl] acetate (PubChem CID 91275561) has the molecular formula C13H22INO3 and a molecular weight of 363.23 g/mol. Its IUPAC name is [3-(1-hydroxy-5-(123I)iodopent-4-enyl)-1-methylpiperidin-4-yl] acetate.
| Compound Name | [3-(1-hydroxy-5-(123I)iodopent-4-enyl)-1-methylpiperidin-4-yl] acetate |
|---|---|
| PubChem CID | 91275561 |
| Molecular Formula | C13H22INO3 |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [3-(1-hydroxy-5-(123I)iodopent-4-enyl)-1-methylpiperidin-4-yl] acetate |
| SMILES | CC(=O)OC1CCN(C)CC1C(O)CCC=C[123I] |
| InChI | InChI=1S/C13H22INO3/c1-10(16)18-13-6-8-15(2)9-11(13)12(17)5-3-4-7-14/h4,7,11-13,17H,3,5-6,8-9H2,1-2H3/i14-4 |
| InChIKey | XNVRIHDDXPCBLW-CKVWVWRJSA-N |
| XLogP | 1.96 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|