C16H22F2N2O2 — CID 18677668
(3,5-difluorophenyl)methyl N-piperidin-4-yl-N-propylcarbamate (PubChem CID 18677668) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is (3,5-difluorophenyl)methyl N-piperidin-4-yl-N-propylcarbamate.
| Compound Name | (3,5-difluorophenyl)methyl N-piperidin-4-yl-N-propylcarbamate |
|---|---|
| PubChem CID | 18677668 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (3,5-difluorophenyl)methyl N-piperidin-4-yl-N-propylcarbamate |
| SMILES | CCCN(C(=O)OCc1cc(F)cc(F)c1)C1CCNCC1 |
| InChI | InChI=1S/C16H22F2N2O2/c1-2-7-20(15-3-5-19-6-4-15)16(21)22-11-12-8-13(17)10-14(18)9-12/h8-10,15,19H,2-7,11H2,1H3 |
| InChIKey | YTMLNJUSBBVSQP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |