C24H30FN3O8S — CID 18678626
2-[4-[[[4-[4-(dimethoxymethyl)piperidin-1-yl]sulfonylphenyl]carbamoylamino]methyl]-3-fluorophenoxy]acetic acid (PubChem CID 18678626) has the molecular formula C24H30FN3O8S and a molecular weight of 539.58 g/mol. Its IUPAC name is 2-[4-[[[4-[4-(dimethoxymethyl)piperidin-1-yl]sulfonylphenyl]carbamoylamino]methyl]-3-fluorophenoxy]acetic acid.
| Compound Name | 2-[4-[[[4-[4-(dimethoxymethyl)piperidin-1-yl]sulfonylphenyl]carbamoylamino]methyl]-3-fluorophenoxy]acetic acid |
|---|---|
| PubChem CID | 18678626 |
| Molecular Formula | C24H30FN3O8S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 2-[4-[[[4-[4-(dimethoxymethyl)piperidin-1-yl]sulfonylphenyl]carbamoylamino]methyl]-3-fluorophenoxy]acetic acid |
| SMILES | COC(OC)C1CCN(S(=O)(=O)c2ccc(NC(=O)NCc3ccc(OCC(=O)O)cc3F)cc2)CC1 |
| InChI | InChI=1S/C24H30FN3O8S/c1-34-23(35-2)16-9-11-28(12-10-16)37(32,33)20-7-4-18(5-8-20)27-24(31)26-14-17-3-6-19(13-21(17)25)36-15-22(29)30/h3-8,13,16,23H,9-12,14-15H2,1-2H3,(H,29,30)(H2,26,27,31) |
| InChIKey | QQYQHDVOBMTSSU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|