C15H23N3O2 — CID 18682015
6-oxo-N-(3,3,5,5-tetramethylcyclohexyl)-1H-pyrimidine-5-carboxamide (PubChem CID 18682015) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 6-oxo-N-(3,3,5,5-tetramethylcyclohexyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 6-oxo-N-(3,3,5,5-tetramethylcyclohexyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 18682015 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 6-oxo-N-(3,3,5,5-tetramethylcyclohexyl)-1H-pyrimidine-5-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2cnc[nH]c2=O)CC(C)(C)C1 |
| InChI | InChI=1S/C15H23N3O2/c1-14(2)5-10(6-15(3,4)8-14)18-13(20)11-7-16-9-17-12(11)19/h7,9-10H,5-6,8H2,1-4H3,(H,18,20)(H,16,17,19) |
| InChIKey | UUHZGIOYVMDUGM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |