C8H10N+ — CID 18684139
5,6-dihydro-1H-indolizin-4-ium (PubChem CID 18684139) has the molecular formula C8H10N+ and a molecular weight of 120.17 g/mol. Its IUPAC name is 5,6-dihydro-1H-indolizin-4-ium.
| Compound Name | 5,6-dihydro-1H-indolizin-4-ium |
|---|---|
| PubChem CID | 18684139 |
| Molecular Formula | C8H10N+ |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | 5,6-dihydro-1H-indolizin-4-ium |
| SMILES | C1=CC2=[N+](C=CC2)CC1 |
| InChI | InChI=1S/C8H10N/c1-2-6-9-7-3-5-8(9)4-1/h1,3-4,7H,2,5-6H2/q+1 |
| InChIKey | PAURGYUFUOLIHY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|