About carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine
carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine (PubChem CID 59403546) has the molecular formula C9H13IrN-2
and a molecular weight of 327.43 g/mol. Its IUPAC name is carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine |
| PubChem CID | 59403546 |
| Molecular Formula | C9H13IrN-2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine |
| SMILES | C/[C-]=C/C1=NC=CCC1.[CH3-].[Ir] |
| InChI | InChI=1S/C8H10N.CH3.Ir/c1-2-5-8-6-3-4-7-9-8;;/h4-5,7H,3,6H2,1H3;1H3;/q2*-1; |
| InChIKey | JRMFDEDRXFTZCQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine?
The IUPAC name of carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine (CID 59403546) is carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine.
What is the SMILES notation for carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine?
The canonical SMILES for carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine is C/[C-]=C/C1=NC=CCC1.[CH3-].[Ir].
What is the InChIKey of carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine?
The InChIKey is JRMFDEDRXFTZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N.CH3.Ir/c1-2-5-8-6-3-4-7-9-8;;/h4-5,7H,3,6H2,1H3;1H3;/q2*-1;.
What are the key properties of carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine?
carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine has a molecular weight of 327.43 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;iridium;2-prop-1-enyl-3,4-dihydropyridine is sourced from PubChem (CID 59403546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).