C11H14N2 — CID 89014932
2,5-diethyl-3aH-pyrrolo[3,2-b]pyridine (PubChem CID 89014932) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 2,5-diethyl-3aH-pyrrolo[3,2-b]pyridine.
| Compound Name | 2,5-diethyl-3aH-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 89014932 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2,5-diethyl-3aH-pyrrolo[3,2-b]pyridine |
| SMILES | CCC1=CC2N=C(CC)C=CC2=N1 |
| InChI | InChI=1S/C11H14N2/c1-3-8-5-6-10-11(12-8)7-9(4-2)13-10/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | IVCDIWPSUPRVGH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |