C18H13MgN3O+2 — CID 18684208
magnesium 2-(3-phenylimidazo[4,5-b]pyridin-1-ium-2-yl)phenolate (PubChem CID 18684208) has the molecular formula C18H13MgN3O+2 and a molecular weight of 311.63 g/mol. Its IUPAC name is magnesium 2-(3-phenylimidazo[4,5-b]pyridin-1-ium-2-yl)phenolate.
| Compound Name | magnesium 2-(3-phenylimidazo[4,5-b]pyridin-1-ium-2-yl)phenolate |
|---|---|
| PubChem CID | 18684208 |
| Molecular Formula | C18H13MgN3O+2 |
| Molecular Weight | 311.63 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | magnesium 2-(3-phenylimidazo[4,5-b]pyridin-1-ium-2-yl)phenolate |
| SMILES | [Mg+2].[O-]c1ccccc1-c1[nH+]c2cccnc2n1-c1ccccc1 |
| InChI | InChI=1S/C18H13N3O.Mg/c22-16-11-5-4-9-14(16)17-20-15-10-6-12-19-18(15)21(17)13-7-2-1-3-8-13;/h1-12,22H;/q;+2 |
| InChIKey | BHZJKMIXCLVMKT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.63 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |