C23H18O6 — CID 18684440
4-[[3-(dihydroxymethyl)-4-hydroxynaphthalen-1-yl]methyl]-1-hydroxynaphthalene-2-carboxylic acid (PubChem CID 18684440) has the molecular formula C23H18O6 and a molecular weight of 390.39 g/mol. Its IUPAC name is 4-[[3-(dihydroxymethyl)-4-hydroxynaphthalen-1-yl]methyl]-1-hydroxynaphthalene-2-carboxylic acid.
| Compound Name | 4-[[3-(dihydroxymethyl)-4-hydroxynaphthalen-1-yl]methyl]-1-hydroxynaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 18684440 |
| Molecular Formula | C23H18O6 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 4-[[3-(dihydroxymethyl)-4-hydroxynaphthalen-1-yl]methyl]-1-hydroxynaphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Cc2cc(C(O)O)c(O)c3ccccc23)c2ccccc2c1O |
| InChI | InChI=1S/C23H18O6/c24-20-16-7-3-1-5-14(16)12(10-18(20)22(26)27)9-13-11-19(23(28)29)21(25)17-8-4-2-6-15(13)17/h1-8,10-11,22,24-27H,9H2,(H,28,29) |
| InChIKey | JEVXXESBVDZXIQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|