C17H14F3N3 — CID 18685583
6,7-dimethyl-N-[2-(trifluoromethyl)phenyl]quinazolin-4-amine (PubChem CID 18685583) has the molecular formula C17H14F3N3 and a molecular weight of 317.31 g/mol. Its IUPAC name is 6,7-dimethyl-N-[2-(trifluoromethyl)phenyl]quinazolin-4-amine.
| Compound Name | 6,7-dimethyl-N-[2-(trifluoromethyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 18685583 |
| Molecular Formula | C17H14F3N3 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 6,7-dimethyl-N-[2-(trifluoromethyl)phenyl]quinazolin-4-amine |
| SMILES | Cc1cc2ncnc(Nc3ccccc3C(F)(F)F)c2cc1C |
| InChI | InChI=1S/C17H14F3N3/c1-10-7-12-15(8-11(10)2)21-9-22-16(12)23-14-6-4-3-5-13(14)17(18,19)20/h3-9H,1-2H3,(H,21,22,23) |
| InChIKey | KAAWVRMVDVTHAB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |