C18H13F6N3 — CID 18685602
N-[3,5-bis(trifluoromethyl)phenyl]-6,7-dimethylquinazolin-4-amine (PubChem CID 18685602) has the molecular formula C18H13F6N3 and a molecular weight of 385.31 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-6,7-dimethylquinazolin-4-amine.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-6,7-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 18685602 |
| Molecular Formula | C18H13F6N3 |
| Molecular Weight | 385.31 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-6,7-dimethylquinazolin-4-amine |
| SMILES | Cc1cc2ncnc(Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2cc1C |
| InChI | InChI=1S/C18H13F6N3/c1-9-3-14-15(4-10(9)2)25-8-26-16(14)27-13-6-11(17(19,20)21)5-12(7-13)18(22,23)24/h3-8H,1-2H3,(H,25,26,27) |
| InChIKey | MDVBLEUXRQOLPX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.31 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |