C15H17N3O6S — CID 18685833
2-(methanesulfonamido)-3-[(1-methyl-4-oxoquinoline-3-carbonyl)amino]propanoic acid (PubChem CID 18685833) has the molecular formula C15H17N3O6S and a molecular weight of 367.38 g/mol. Its IUPAC name is 2-(methanesulfonamido)-3-[(1-methyl-4-oxoquinoline-3-carbonyl)amino]propanoic acid.
| Compound Name | 2-(methanesulfonamido)-3-[(1-methyl-4-oxoquinoline-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 18685833 |
| Molecular Formula | C15H17N3O6S |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 2-(methanesulfonamido)-3-[(1-methyl-4-oxoquinoline-3-carbonyl)amino]propanoic acid |
| SMILES | Cn1cc(C(=O)NCC(NS(C)(=O)=O)C(=O)O)c(=O)c2ccccc21 |
| InChI | InChI=1S/C15H17N3O6S/c1-18-8-10(13(19)9-5-3-4-6-12(9)18)14(20)16-7-11(15(21)22)17-25(2,23)24/h3-6,8,11,17H,7H2,1-2H3,(H,16,20)(H,21,22) |
| InChIKey | UJHJGBOFSBHKSY-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |