C23H23N4O+ — CID 18686014
N-(4-phenylbutan-2-yl)-2-pyridin-1-ium-4-yl-3H-benzimidazole-5-carboxamide (PubChem CID 18686014) has the molecular formula C23H23N4O+ and a molecular weight of 371.46 g/mol. Its IUPAC name is N-(4-phenylbutan-2-yl)-2-pyridin-1-ium-4-yl-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(4-phenylbutan-2-yl)-2-pyridin-1-ium-4-yl-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 18686014 |
| Molecular Formula | C23H23N4O+ |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-(4-phenylbutan-2-yl)-2-pyridin-1-ium-4-yl-3H-benzimidazole-5-carboxamide |
| SMILES | CC(CCc1ccccc1)NC(=O)c1ccc2nc(-c3cc[nH+]cc3)[nH]c2c1 |
| InChI | InChI=1S/C23H22N4O/c1-16(7-8-17-5-3-2-4-6-17)25-23(28)19-9-10-20-21(15-19)27-22(26-20)18-11-13-24-14-12-18/h2-6,9-16H,7-8H2,1H3,(H,25,28)(H,26,27)/p+1 |
| InChIKey | NEMHOHMOVZKVLD-UHFFFAOYSA-O |
| XLogP | 3.80 |
| TPSA | 71.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |